C23H20N4O5S — CID 19658750
[4-[(E)-N-[[2-(4-acetamidoanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] thiophene-2-carboxylate (PubChem CID 19658750) has the molecular formula C23H20N4O5S and a molecular weight of 464.50 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(4-acetamidoanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-N-[[2-(4-acetamidoanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19658750 |
| Molecular Formula | C23H20N4O5S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.12 |
| IUPAC Name | [4-[(E)-N-[[2-(4-acetamidoanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] thiophene-2-carboxylate |
| SMILES | CC(=O)Nc1ccc(NC(=O)C(=O)N/N=C(\C)c2ccc(OC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C23H20N4O5S/c1-14(16-5-11-19(12-6-16)32-23(31)20-4-3-13-33-20)26-27-22(30)21(29)25-18-9-7-17(8-10-18)24-15(2)28/h3-13H,1-2H3,(H,24,28)(H,25,29)(H,27,30)/b26-14+ |
| InChIKey | VKRMWHFIUKHNBW-VULFUBBASA-N |
| XLogP | 3.40 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|