C22H17Cl2N3O5S — CID 19660207
[4-[(E)-N-[[2-(3,5-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 19660207) has the molecular formula C22H17Cl2N3O5S and a molecular weight of 506.37 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(3,5-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-N-[[2-(3,5-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19660207 |
| Molecular Formula | C22H17Cl2N3O5S |
| Molecular Weight | 506.37 g/mol |
| Exact Mass | 505.03 |
| IUPAC Name | [4-[(E)-N-[[2-(3,5-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2cc(Cl)cc(Cl)c2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H17Cl2N3O5S/c1-12(26-27-21(29)20(28)25-16-10-14(23)9-15(24)11-16)13-5-6-17(18(8-13)31-2)32-22(30)19-4-3-7-33-19/h3-11H,1-2H3,(H,25,28)(H,27,29)/b26-12+ |
| InChIKey | OLXDMRUEUYMPOS-RPPGKUMJSA-N |
| XLogP | 4.76 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|