C22H18ClN3O5S — CID 19660593
[4-[(E)-N-[[2-(2-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 19660593) has the molecular formula C22H18ClN3O5S and a molecular weight of 471.92 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(2-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-N-[[2-(2-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19660593 |
| Molecular Formula | C22H18ClN3O5S |
| Molecular Weight | 471.92 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | [4-[(E)-N-[[2-(2-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2ccccc2Cl)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H18ClN3O5S/c1-13(25-26-21(28)20(27)24-16-7-4-3-6-15(16)23)14-9-10-17(18(12-14)30-2)31-22(29)19-8-5-11-32-19/h3-12H,1-2H3,(H,24,27)(H,26,28)/b25-13+ |
| InChIKey | LRLUEWSLKXQFMY-DHRITJCHSA-N |
| XLogP | 4.11 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.92 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|