C25H22N4O8 — CID 4245077
[2-methoxy-4-[N-[[2-(2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-nitrobenzoate (PubChem CID 4245077) has the molecular formula C25H22N4O8 and a molecular weight of 506.47 g/mol. Its IUPAC name is [2-methoxy-4-[N-[[2-(2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-nitrobenzoate.
| Compound Name | [2-methoxy-4-[N-[[2-(2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 4245077 |
| Molecular Formula | C25H22N4O8 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.14 |
| IUPAC Name | [2-methoxy-4-[N-[[2-(2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-nitrobenzoate |
| SMILES | COc1ccccc1NC(=O)C(=O)NN=C(C)c1ccc(OC(=O)c2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C25H22N4O8/c1-15(27-28-24(31)23(30)26-19-6-4-5-7-20(19)35-2)17-10-13-21(22(14-17)36-3)37-25(32)16-8-11-18(12-9-16)29(33)34/h4-14H,1-3H3,(H,26,30)(H,28,31) |
| InChIKey | ZEPJQLYYOTWZIT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 158.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|