C27H27N3O6 — CID 19661363
[4-[(E)-N-[[2-(2-ethoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate (PubChem CID 19661363) has the molecular formula C27H27N3O6 and a molecular weight of 489.53 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(2-ethoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate.
| Compound Name | [4-[(E)-N-[[2-(2-ethoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19661363 |
| Molecular Formula | C27H27N3O6 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | [4-[(E)-N-[[2-(2-ethoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N/N=C(\C)c1ccc(OC(=O)c2ccccc2C)c(OC)c1 |
| InChI | InChI=1S/C27H27N3O6/c1-5-35-22-13-9-8-12-21(22)28-25(31)26(32)30-29-18(3)19-14-15-23(24(16-19)34-4)36-27(33)20-11-7-6-10-17(20)2/h6-16H,5H2,1-4H3,(H,28,31)(H,30,32)/b29-18+ |
| InChIKey | LNEAUXZNGYNSNX-RDRPBHBLSA-N |
| XLogP | 4.10 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|