C28H26ClN3O7S — CID 19659533
ethyl 2-[[2-[(2E)-2-[1-[4-(2-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 19659533) has the molecular formula C28H26ClN3O7S and a molecular weight of 584.05 g/mol. Its IUPAC name is ethyl 2-[[2-[(2E)-2-[1-[4-(2-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2E)-2-[1-[4-(2-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19659533 |
| Molecular Formula | C28H26ClN3O7S |
| Molecular Weight | 584.05 g/mol |
| Exact Mass | 583.12 |
| IUPAC Name | ethyl 2-[[2-[(2E)-2-[1-[4-(2-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)N/N=C(\C)c2ccc(OC(=O)c3ccccc3Cl)c(OC)c2)sc2c1CCC2 |
| InChI | InChI=1S/C28H26ClN3O7S/c1-4-38-28(36)23-18-9-7-11-22(18)40-26(23)30-24(33)25(34)32-31-15(2)16-12-13-20(21(14-16)37-3)39-27(35)17-8-5-6-10-19(17)29/h5-6,8,10,12-14H,4,7,9,11H2,1-3H3,(H,30,33)(H,32,34)/b31-15+ |
| InChIKey | SNVRCJUMWZCAHQ-IBBHUPRXSA-N |
| XLogP | 4.77 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.05 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|