C28H27N3O8S — CID 4615611
methyl 2-[[2-[2-[1-[3-methoxy-4-(3-methoxybenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 4615611) has the molecular formula C28H27N3O8S and a molecular weight of 565.60 g/mol. Its IUPAC name is methyl 2-[[2-[2-[1-[3-methoxy-4-(3-methoxybenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[2-[1-[3-methoxy-4-(3-methoxybenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 4615611 |
| Molecular Formula | C28H27N3O8S |
| Molecular Weight | 565.60 g/mol |
| Exact Mass | 565.15 |
| IUPAC Name | methyl 2-[[2-[2-[1-[3-methoxy-4-(3-methoxybenzoyl)oxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)NN=C(C)c2ccc(OC(=O)c3cccc(OC)c3)c(OC)c2)sc2c1CCC2 |
| InChI | InChI=1S/C28H27N3O8S/c1-15(16-11-12-20(21(14-16)37-3)39-27(34)17-7-5-8-18(13-17)36-2)30-31-25(33)24(32)29-26-23(28(35)38-4)19-9-6-10-22(19)40-26/h5,7-8,11-14H,6,9-10H2,1-4H3,(H,29,32)(H,31,33) |
| InChIKey | CATSIJVVDKBUTA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.60 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|