C26H22F3N3O6 — CID 19661391
[2-methoxy-4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 3-methoxybenzoate (PubChem CID 19661391) has the molecular formula C26H22F3N3O6 and a molecular weight of 529.47 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 3-methoxybenzoate.
| Compound Name | [2-methoxy-4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19661391 |
| Molecular Formula | C26H22F3N3O6 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [2-methoxy-4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(/C(C)=N/NC(=O)C(=O)Nc3ccc(C(F)(F)F)cc3)cc2OC)c1 |
| InChI | InChI=1S/C26H22F3N3O6/c1-15(31-32-24(34)23(33)30-19-10-8-18(9-11-19)26(27,28)29)16-7-12-21(22(14-16)37-3)38-25(35)17-5-4-6-20(13-17)36-2/h4-14H,1-3H3,(H,30,33)(H,32,34)/b31-15+ |
| InChIKey | STNDCEXXCNYCGR-IBBHUPRXSA-N |
| XLogP | 4.42 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|