C25H22ClN3O6 — CID 19661211
[4-[(E)-N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 19661211) has the molecular formula C25H22ClN3O6 and a molecular weight of 495.92 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[(E)-N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19661211 |
| Molecular Formula | C25H22ClN3O6 |
| Molecular Weight | 495.92 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | [4-[(E)-N-[[2-(4-chloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(/C(C)=N/NC(=O)C(=O)Nc3ccc(Cl)cc3)cc2OC)c1 |
| InChI | InChI=1S/C25H22ClN3O6/c1-15(28-29-24(31)23(30)27-19-10-8-18(26)9-11-19)16-7-12-21(22(14-16)34-3)35-25(32)17-5-4-6-20(13-17)33-2/h4-14H,1-3H3,(H,27,30)(H,29,31)/b28-15+ |
| InChIKey | PYYKYQDGKBFCAQ-RWPZCVJISA-N |
| XLogP | 4.06 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.92 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|