C26H24ClN3O6 — CID 3599300
[4-[N-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-methylbenzoate (PubChem CID 3599300) has the molecular formula C26H24ClN3O6 and a molecular weight of 509.95 g/mol. Its IUPAC name is [4-[N-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-methylbenzoate.
| Compound Name | [4-[N-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 3599300 |
| Molecular Formula | C26H24ClN3O6 |
| Molecular Weight | 509.95 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | [4-[N-[[2-(5-chloro-2-methoxyanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 4-methylbenzoate |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)NN=C(C)c1ccc(OC(=O)c2ccc(C)cc2)c(OC)c1 |
| InChI | InChI=1S/C26H24ClN3O6/c1-15-5-7-17(8-6-15)26(33)36-22-11-9-18(13-23(22)35-4)16(2)29-30-25(32)24(31)28-20-14-19(27)10-12-21(20)34-3/h5-14H,1-4H3,(H,28,31)(H,30,32) |
| InChIKey | PREDYXIDVVLXQF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.95 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|