C25H21Cl2N3O5 — CID 19661579
[4-[(E)-N-[[2-(2,3-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate (PubChem CID 19661579) has the molecular formula C25H21Cl2N3O5 and a molecular weight of 514.37 g/mol. Its IUPAC name is [4-[(E)-N-[[2-(2,3-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate.
| Compound Name | [4-[(E)-N-[[2-(2,3-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19661579 |
| Molecular Formula | C25H21Cl2N3O5 |
| Molecular Weight | 514.37 g/mol |
| Exact Mass | 513.09 |
| IUPAC Name | [4-[(E)-N-[[2-(2,3-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-methylbenzoate |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2cccc(Cl)c2Cl)ccc1OC(=O)c1ccccc1C |
| InChI | InChI=1S/C25H21Cl2N3O5/c1-14-7-4-5-8-17(14)25(33)35-20-12-11-16(13-21(20)34-3)15(2)29-30-24(32)23(31)28-19-10-6-9-18(26)22(19)27/h4-13H,1-3H3,(H,28,31)(H,30,32)/b29-15+ |
| InChIKey | VDJBJGOZWSISIB-WKULSOCRSA-N |
| XLogP | 5.01 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|