C24H19Cl4N3O4 — CID 19658163
N-(2,3-dichlorophenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide (PubChem CID 19658163) has the molecular formula C24H19Cl4N3O4 and a molecular weight of 555.25 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide.
| Compound Name | N-(2,3-dichlorophenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19658163 |
| Molecular Formula | C24H19Cl4N3O4 |
| Molecular Weight | 555.25 g/mol |
| Exact Mass | 553.01 |
| IUPAC Name | N-(2,3-dichlorophenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2cccc(Cl)c2Cl)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H19Cl4N3O4/c1-13(30-31-24(33)23(32)29-19-5-3-4-17(26)22(19)28)14-7-9-20(21(10-14)34-2)35-12-15-6-8-16(25)11-18(15)27/h3-11H,12H2,1-2H3,(H,29,32)(H,31,33)/b30-13+ |
| InChIKey | JUVKIRXWWWIYEJ-VVEOGCPPSA-N |
| XLogP | 6.37 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.25 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|