C25H22Cl3N3O4 — CID 19659943
N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide (PubChem CID 19659943) has the molecular formula C25H22Cl3N3O4 and a molecular weight of 534.83 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19659943 |
| Molecular Formula | C25H22Cl3N3O4 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]ethylideneamino]oxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2ccc(C)c(Cl)c2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H22Cl3N3O4/c1-14-7-9-17(12-21(14)28)29-24(32)25(33)31-30-15(2)16-8-10-22(23(11-16)34-3)35-13-18-19(26)5-4-6-20(18)27/h4-12H,13H2,1-3H3,(H,29,32)(H,31,33)/b30-15+ |
| InChIKey | VGMOIQVLYVPWBX-FJEPWZHXSA-N |
| XLogP | 6.02 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|