C24H20ClN5O8 — CID 19661726
N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide (PubChem CID 19661726) has the molecular formula C24H20ClN5O8 and a molecular weight of 541.90 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19661726 |
| Molecular Formula | C24H20ClN5O8 |
| Molecular Weight | 541.90 g/mol |
| Exact Mass | 541.10 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-N'-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2ccc(C)c(Cl)c2)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H20ClN5O8/c1-13-4-6-16(11-18(13)25)26-23(31)24(32)28-27-14(2)15-5-8-21(22(10-15)37-3)38-20-9-7-17(29(33)34)12-19(20)30(35)36/h4-12H,1-3H3,(H,26,31)(H,28,32)/b27-14+ |
| InChIKey | YCALKVZPGSKEFY-MZJWZYIUSA-N |
| XLogP | 4.74 |
| TPSA | 175.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|