C23H23N7O9 — CID 19661623
2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]propanamide (PubChem CID 19661623) has the molecular formula C23H23N7O9 and a molecular weight of 541.48 g/mol. Its IUPAC name is 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]propanamide.
| Compound Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]propanamide |
|---|---|
| PubChem CID | 19661623 |
| Molecular Formula | C23H23N7O9 |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-(3,5-dimethyl-4-nitropyrazol-1-yl)-N-[(E)-1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]propanamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(C)n2nc(C)c([N+](=O)[O-])c2C)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23N7O9/c1-12(24-25-23(31)15(4)27-14(3)22(30(36)37)13(2)26-27)16-6-8-20(21(10-16)38-5)39-19-9-7-17(28(32)33)11-18(19)29(34)35/h6-11,15H,1-5H3,(H,25,31)/b24-12+ |
| InChIKey | IRDSQNCMHJXQFM-WYMPLXKRSA-N |
| XLogP | 4.13 |
| TPSA | 207.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|