C24H24BrN5O6 — CID 19659540
[4-[(E)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-bromobenzoate (PubChem CID 19659540) has the molecular formula C24H24BrN5O6 and a molecular weight of 558.39 g/mol. Its IUPAC name is [4-[(E)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-bromobenzoate.
| Compound Name | [4-[(E)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 19659540 |
| Molecular Formula | C24H24BrN5O6 |
| Molecular Weight | 558.39 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | [4-[(E)-N-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)propanoylamino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-bromobenzoate |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(C)n2nc(C)c([N+](=O)[O-])c2C)ccc1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C24H24BrN5O6/c1-13(26-27-23(31)16(4)29-15(3)22(30(33)34)14(2)28-29)17-10-11-20(21(12-17)35-5)36-24(32)18-8-6-7-9-19(18)25/h6-12,16H,1-5H3,(H,27,31)/b26-13+ |
| InChIKey | PJULZBZXMXWAHX-LGJNPRDNSA-N |
| XLogP | 4.50 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.39 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|