C21H18BrN5O6 — CID 19660877
[2-methoxy-4-[(E)-C-methyl-N-[[2-(4-nitropyrazol-1-yl)acetyl]amino]carbonimidoyl]phenyl] 2-bromobenzoate (PubChem CID 19660877) has the molecular formula C21H18BrN5O6 and a molecular weight of 516.31 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-C-methyl-N-[[2-(4-nitropyrazol-1-yl)acetyl]amino]carbonimidoyl]phenyl] 2-bromobenzoate.
| Compound Name | [2-methoxy-4-[(E)-C-methyl-N-[[2-(4-nitropyrazol-1-yl)acetyl]amino]carbonimidoyl]phenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 19660877 |
| Molecular Formula | C21H18BrN5O6 |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 515.04 |
| IUPAC Name | [2-methoxy-4-[(E)-C-methyl-N-[[2-(4-nitropyrazol-1-yl)acetyl]amino]carbonimidoyl]phenyl] 2-bromobenzoate |
| SMILES | COc1cc(/C(C)=N/NC(=O)Cn2cc([N+](=O)[O-])cn2)ccc1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C21H18BrN5O6/c1-13(24-25-20(28)12-26-11-15(10-23-26)27(30)31)14-7-8-18(19(9-14)32-2)33-21(29)16-5-3-4-6-17(16)22/h3-11H,12H2,1-2H3,(H,25,28)/b24-13+ |
| InChIKey | QDTXANRGEPBTTH-ZMOGYAJESA-N |
| XLogP | 3.32 |
| TPSA | 137.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|