C25H22BrN3O7 — CID 3097229
[4-[[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate (PubChem CID 3097229) has the molecular formula C25H22BrN3O7 and a molecular weight of 556.37 g/mol. Its IUPAC name is [4-[[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate.
| Compound Name | [4-[[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate |
|---|---|
| PubChem CID | 3097229 |
| Molecular Formula | C25H22BrN3O7 |
| Molecular Weight | 556.37 g/mol |
| Exact Mass | 555.06 |
| IUPAC Name | [4-[[[2-(2,6-dimethyl-4-nitrophenoxy)acetyl]hydrazinylidene]methyl]-2-methoxyphenyl] 2-bromobenzoate |
| SMILES | COc1cc(C=NNC(=O)COc2c(C)cc([N+](=O)[O-])cc2C)ccc1OC(=O)c1ccccc1Br |
| InChI | InChI=1S/C25H22BrN3O7/c1-15-10-18(29(32)33)11-16(2)24(15)35-14-23(30)28-27-13-17-8-9-21(22(12-17)34-3)36-25(31)19-6-4-5-7-20(19)26/h4-13H,14H2,1-3H3,(H,28,30) |
| InChIKey | QHEBLVYUTCSDTF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|