C25H21N5O8 — CID 3335730
[4-[N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-nitrobenzoate (PubChem CID 3335730) has the molecular formula C25H21N5O8 and a molecular weight of 519.47 g/mol. Its IUPAC name is [4-[N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-nitrobenzoate.
| Compound Name | [4-[N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 3335730 |
| Molecular Formula | C25H21N5O8 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | [4-[N-[[2-(4-carbamoylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]-2-methoxyphenyl] 2-nitrobenzoate |
| SMILES | COc1cc(C(C)=NNC(=O)C(=O)Nc2ccc(C(N)=O)cc2)ccc1OC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N5O8/c1-14(28-29-24(33)23(32)27-17-10-7-15(8-11-17)22(26)31)16-9-12-20(21(13-16)37-2)38-25(34)18-5-3-4-6-19(18)30(35)36/h3-13H,1-2H3,(H2,26,31)(H,27,32)(H,29,33) |
| InChIKey | MCJAVRGOVVEZBQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 192.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|