C25H22N4O6 — CID 4149148
[4-[N-[[2-(3,4-dimethylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 2-nitrobenzoate (PubChem CID 4149148) has the molecular formula C25H22N4O6 and a molecular weight of 474.47 g/mol. Its IUPAC name is [4-[N-[[2-(3,4-dimethylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 2-nitrobenzoate.
| Compound Name | [4-[N-[[2-(3,4-dimethylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 4149148 |
| Molecular Formula | C25H22N4O6 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | [4-[N-[[2-(3,4-dimethylanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 2-nitrobenzoate |
| SMILES | CC(=NNC(=O)C(=O)Nc1ccc(C)c(C)c1)c1ccc(OC(=O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H22N4O6/c1-15-8-11-19(14-16(15)2)26-23(30)24(31)28-27-17(3)18-9-12-20(13-10-18)35-25(32)21-6-4-5-7-22(21)29(33)34/h4-14H,1-3H3,(H,26,30)(H,28,31) |
| InChIKey | XKDZRFXPXYJFQT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 140.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|