C23H16Cl3N3O4 — CID 4140531
[4-[N-[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate (PubChem CID 4140531) has the molecular formula C23H16Cl3N3O4 and a molecular weight of 504.76 g/mol. Its IUPAC name is [4-[N-[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate.
| Compound Name | [4-[N-[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4140531 |
| Molecular Formula | C23H16Cl3N3O4 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 503.02 |
| IUPAC Name | [4-[N-[[2-(3,4-dichloroanilino)-2-oxoacetyl]amino]-C-methylcarbonimidoyl]phenyl] 4-chlorobenzoate |
| SMILES | CC(=NNC(=O)C(=O)Nc1ccc(Cl)c(Cl)c1)c1ccc(OC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H16Cl3N3O4/c1-13(28-29-22(31)21(30)27-17-8-11-19(25)20(26)12-17)14-4-9-18(10-5-14)33-23(32)15-2-6-16(24)7-3-15/h2-12H,1H3,(H,27,30)(H,29,31) |
| InChIKey | UWVCCKFIFUBLCH-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|