C25H20F3N3O5 — CID 19658629
[4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 4-methoxybenzoate (PubChem CID 19658629) has the molecular formula C25H20F3N3O5 and a molecular weight of 499.45 g/mol. Its IUPAC name is [4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 19658629 |
| Molecular Formula | C25H20F3N3O5 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.14 |
| IUPAC Name | [4-[(E)-C-methyl-N-[[2-oxo-2-[4-(trifluoromethyl)anilino]acetyl]amino]carbonimidoyl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(/C(C)=N/NC(=O)C(=O)Nc3ccc(C(F)(F)F)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H20F3N3O5/c1-15(30-31-23(33)22(32)29-19-9-7-18(8-10-19)25(26,27)28)16-3-13-21(14-4-16)36-24(34)17-5-11-20(35-2)12-6-17/h3-14H,1-2H3,(H,29,32)(H,31,33)/b30-15+ |
| InChIKey | JCQBLQFHWKARLY-FJEPWZHXSA-N |
| XLogP | 4.41 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|