C19H14ClN5O5 — CID 19660229
[3-[(E)-[[2-(4-nitropyrazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate (PubChem CID 19660229) has the molecular formula C19H14ClN5O5 and a molecular weight of 427.80 g/mol. Its IUPAC name is [3-[(E)-[[2-(4-nitropyrazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate.
| Compound Name | [3-[(E)-[[2-(4-nitropyrazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 19660229 |
| Molecular Formula | C19H14ClN5O5 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | [3-[(E)-[[2-(4-nitropyrazol-1-yl)acetyl]hydrazinylidene]methyl]phenyl] 2-chlorobenzoate |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)N/N=C/c1cccc(OC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C19H14ClN5O5/c20-17-7-2-1-6-16(17)19(27)30-15-5-3-4-13(8-15)9-21-23-18(26)12-24-11-14(10-22-24)25(28)29/h1-11H,12H2,(H,23,26)/b21-9+ |
| InChIKey | QYDZMKGNBGNGSN-ZVBGSRNCSA-N |
| XLogP | 2.81 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|