C20H16BrClFN5O5 — CID 19659756
N-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 19659756) has the molecular formula C20H16BrClFN5O5 and a molecular weight of 540.73 g/mol. Its IUPAC name is N-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19659756 |
| Molecular Formula | C20H16BrClFN5O5 |
| Molecular Weight | 540.73 g/mol |
| Exact Mass | 539.00 |
| IUPAC Name | N-[(E)-[3-bromo-4-[(2-chloro-6-fluorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | COc1cc(/C=N/NC(=O)Cn2cc([N+](=O)[O-])cn2)cc(Br)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C20H16BrClFN5O5/c1-32-18-6-12(7-24-26-19(29)10-27-9-13(8-25-27)28(30)31)5-15(21)20(18)33-11-14-16(22)3-2-4-17(14)23/h2-9H,10-11H2,1H3,(H,26,29)/b24-7+ |
| InChIKey | FZGCAYKZQBMYSG-HCBMXOAHSA-N |
| XLogP | 4.08 |
| TPSA | 120.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.73 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|