C18H17BrCl2N2O4 — CID 6299739
ethyl N-[(Z)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate (PubChem CID 6299739) has the molecular formula C18H17BrCl2N2O4 and a molecular weight of 476.15 g/mol. Its IUPAC name is ethyl N-[(Z)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate.
| Compound Name | ethyl N-[(Z)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 6299739 |
| Molecular Formula | C18H17BrCl2N2O4 |
| Molecular Weight | 476.15 g/mol |
| Exact Mass | 473.97 |
| IUPAC Name | ethyl N-[(Z)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]carbamate |
| SMILES | CCOC(=O)N/N=C\c1cc(Br)c(OCc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H17BrCl2N2O4/c1-3-26-18(24)23-22-9-11-7-13(19)17(16(8-11)25-2)27-10-12-14(20)5-4-6-15(12)21/h4-9H,3,10H2,1-2H3,(H,23,24)/b22-9- |
| InChIKey | OYACLIARLXUUOH-AFPJDJCSSA-N |
| XLogP | 5.42 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.15 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|