C22H20BrCl2N5O5 — CID 17052842
N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)oxamide (PubChem CID 17052842) has the molecular formula C22H20BrCl2N5O5 and a molecular weight of 585.24 g/mol. Its IUPAC name is N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)oxamide.
| Compound Name | N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 17052842 |
| Molecular Formula | C22H20BrCl2N5O5 |
| Molecular Weight | 585.24 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | N'-[(E)-[3-bromo-4-[(2,6-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]-N-(2,3-dimethyl-5-oxo-1H-pyrazol-4-yl)oxamide |
| SMILES | COc1cc(/C=N/NC(=O)C(=O)Nc2c(C)n(C)[nH]c2=O)cc(Br)c1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C22H20BrCl2N5O5/c1-11-18(20(31)29-30(11)2)27-21(32)22(33)28-26-9-12-7-14(23)19(17(8-12)34-3)35-10-13-15(24)5-4-6-16(13)25/h4-9H,10H2,1-3H3,(H,27,32)(H,28,33)(H,29,31)/b26-9+ |
| InChIKey | ANLYXSLPZVXRFV-JQAMDZJQSA-N |
| XLogP | 3.77 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.24 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|