C19H18Br2N2O5 — CID 17245455
ethyl 2-[2-bromo-4-[(E)-[(2-bromobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 17245455) has the molecular formula C19H18Br2N2O5 and a molecular weight of 514.17 g/mol. Its IUPAC name is ethyl 2-[2-bromo-4-[(E)-[(2-bromobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-bromo-4-[(E)-[(2-bromobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 17245455 |
| Molecular Formula | C19H18Br2N2O5 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | ethyl 2-[2-bromo-4-[(E)-[(2-bromobenzoyl)hydrazinylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Br)cc(/C=N/NC(=O)c2ccccc2Br)cc1OC |
| InChI | InChI=1S/C19H18Br2N2O5/c1-3-27-17(24)11-28-18-15(21)8-12(9-16(18)26-2)10-22-23-19(25)13-6-4-5-7-14(13)20/h4-10H,3,11H2,1-2H3,(H,23,25)/b22-10+ |
| InChIKey | GHYQTCBYOJFPFP-LSHDLFTRSA-N |
| XLogP | 3.93 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|