C20H21ClN2O5 — CID 19061100
ethyl 2-[2-chloro-6-methoxy-4-[(E)-[(2-methylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate (PubChem CID 19061100) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is ethyl 2-[2-chloro-6-methoxy-4-[(E)-[(2-methylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-6-methoxy-4-[(E)-[(2-methylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 19061100 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | ethyl 2-[2-chloro-6-methoxy-4-[(E)-[(2-methylbenzoyl)hydrazinylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=N/NC(=O)c2ccccc2C)cc1OC |
| InChI | InChI=1S/C20H21ClN2O5/c1-4-27-18(24)12-28-19-16(21)9-14(10-17(19)26-3)11-22-23-20(25)15-8-6-5-7-13(15)2/h5-11H,4,12H2,1-3H3,(H,23,25)/b22-11+ |
| InChIKey | NUKVHKWYIUGXRJ-SSDVNMTOSA-N |
| XLogP | 3.36 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|