C12H10ClN5O3 — CID 3572062
N-[(2-chlorophenyl)methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide (PubChem CID 3572062) has the molecular formula C12H10ClN5O3 and a molecular weight of 307.70 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[(2-chlorophenyl)methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 3572062 |
| Molecular Formula | C12H10ClN5O3 |
| Molecular Weight | 307.70 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[(2-chlorophenyl)methylideneamino]-2-(4-nitropyrazol-1-yl)acetamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C12H10ClN5O3/c13-11-4-2-1-3-9(11)5-14-16-12(19)8-17-7-10(6-15-17)18(20)21/h1-7H,8H2,(H,16,19) |
| InChIKey | IRDHFWXYKXUNPR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.70 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|