C28H25N7O9 — CID 4143596
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide (PubChem CID 4143596) has the molecular formula C28H25N7O9 and a molecular weight of 603.55 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 4143596 |
| Molecular Formula | C28H25N7O9 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 603.17 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[1-[4-(2,4-dinitrophenoxy)-3-methoxyphenyl]ethylideneamino]oxamide |
| SMILES | COc1cc(C(C)=NNC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)ccc1Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H25N7O9/c1-16(18-10-12-23(24(14-18)43-4)44-22-13-11-20(34(39)40)15-21(22)35(41)42)30-31-27(37)26(36)29-25-17(2)32(3)33(28(25)38)19-8-6-5-7-9-19/h5-15H,1-4H3,(H,29,36)(H,31,37) |
| InChIKey | QAAQHAWUJMLENC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 202.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|