C30H31N5O5 — CID 19660164
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide (PubChem CID 19660164) has the molecular formula C30H31N5O5 and a molecular weight of 541.61 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19660164 |
| Molecular Formula | C30H31N5O5 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[3-methoxy-4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide |
| SMILES | COc1cc(/C(C)=N/NC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)ccc1OCc1ccccc1C |
| InChI | InChI=1S/C30H31N5O5/c1-19-11-9-10-12-23(19)18-40-25-16-15-22(17-26(25)39-5)20(2)32-33-29(37)28(36)31-27-21(3)34(4)35(30(27)38)24-13-7-6-8-14-24/h6-17H,18H2,1-5H3,(H,31,36)(H,33,37)/b32-20+ |
| InChIKey | ZJZZFOYDDWHXQQ-UZWMFBFFSA-N |
| XLogP | 3.86 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|