C32H29N5O4 — CID 19660439
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide (PubChem CID 19660439) has the molecular formula C32H29N5O4 and a molecular weight of 547.62 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19660439 |
| Molecular Formula | C32H29N5O4 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1c(C)n(C)n(-c2ccccc2)c1=O)c1ccc(OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C32H29N5O4/c1-21(23-16-18-27(19-17-23)41-20-25-12-9-11-24-10-7-8-15-28(24)25)34-35-31(39)30(38)33-29-22(2)36(3)37(32(29)40)26-13-5-4-6-14-26/h4-19H,20H2,1-3H3,(H,33,38)(H,35,39)/b34-21+ |
| InChIKey | UUDARDALZDYCET-KEIPNQJHSA-N |
| XLogP | 4.70 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|