C27H23Cl2N5O4 — CID 19658730
N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide (PubChem CID 19658730) has the molecular formula C27H23Cl2N5O4 and a molecular weight of 552.42 g/mol. Its IUPAC name is N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide.
| Compound Name | N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 19658730 |
| Molecular Formula | C27H23Cl2N5O4 |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 551.11 |
| IUPAC Name | N'-[(E)-[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylideneamino]-N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)oxamide |
| SMILES | Cc1c(NC(=O)C(=O)N/N=C/c2ccc(OCc3ccc(Cl)cc3Cl)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H23Cl2N5O4/c1-17-24(27(37)34(33(17)2)21-6-4-3-5-7-21)31-25(35)26(36)32-30-15-18-8-12-22(13-9-18)38-16-19-10-11-20(28)14-23(19)29/h3-15H,16H2,1-2H3,(H,31,35)(H,32,36)/b30-15+ |
| InChIKey | PIZWSIIVVYKXEQ-FJEPWZHXSA-N |
| XLogP | 4.46 |
| TPSA | 106.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|