C28H25N5O5 — CID 19659857
[3-[(E)-[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate (PubChem CID 19659857) has the molecular formula C28H25N5O5 and a molecular weight of 511.54 g/mol. Its IUPAC name is [3-[(E)-[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate.
| Compound Name | [3-[(E)-[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 19659857 |
| Molecular Formula | C28H25N5O5 |
| Molecular Weight | 511.54 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | [3-[(E)-[[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)Oc1cccc(/C=N/NC(=O)C(=O)Nc2c(C)n(C)n(-c3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C28H25N5O5/c1-18-10-7-8-15-23(18)28(37)38-22-14-9-11-20(16-22)17-29-31-26(35)25(34)30-24-19(2)32(3)33(27(24)36)21-12-5-4-6-13-21/h4-17H,1-3H3,(H,30,34)(H,31,35)/b29-17+ |
| InChIKey | QUPWKXVCIFTZSF-STBIYBPSSA-N |
| XLogP | 3.10 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|