C27H22FN3O3 — CID 19660575
N-(2-fluorophenyl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide (PubChem CID 19660575) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19660575 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(E)-1-[4-(naphthalen-1-ylmethoxy)phenyl]ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccccc1F)c1ccc(OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C27H22FN3O3/c1-18(30-31-27(33)26(32)29-25-12-5-4-11-24(25)28)19-13-15-22(16-14-19)34-17-21-9-6-8-20-7-2-3-10-23(20)21/h2-16H,17H2,1H3,(H,29,32)(H,31,33)/b30-18+ |
| InChIKey | MGOANJSFCKPEDE-UXHLAJHPSA-N |
| XLogP | 5.04 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|