C24H21ClFN3O4 — CID 3618515
N'-[1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethylideneamino]-N-(2-methoxyphenyl)oxamide (PubChem CID 3618515) has the molecular formula C24H21ClFN3O4 and a molecular weight of 469.90 g/mol. Its IUPAC name is N'-[1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethylideneamino]-N-(2-methoxyphenyl)oxamide.
| Compound Name | N'-[1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethylideneamino]-N-(2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 3618515 |
| Molecular Formula | C24H21ClFN3O4 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N'-[1-[4-[(2-chloro-6-fluorophenyl)methoxy]phenyl]ethylideneamino]-N-(2-methoxyphenyl)oxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)NN=C(C)c1ccc(OCc2c(F)cccc2Cl)cc1 |
| InChI | InChI=1S/C24H21ClFN3O4/c1-15(28-29-24(31)23(30)27-21-8-3-4-9-22(21)32-2)16-10-12-17(13-11-16)33-14-18-19(25)6-5-7-20(18)26/h3-13H,14H2,1-2H3,(H,27,30)(H,29,31) |
| InChIKey | XMDIXIMZZJJCON-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|