C24H20Cl2FN3O5 — CID 19661226
N'-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(5-chloro-2-methoxyphenyl)oxamide (PubChem CID 19661226) has the molecular formula C24H20Cl2FN3O5 and a molecular weight of 520.34 g/mol. Its IUPAC name is N'-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(5-chloro-2-methoxyphenyl)oxamide.
| Compound Name | N'-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(5-chloro-2-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 19661226 |
| Molecular Formula | C24H20Cl2FN3O5 |
| Molecular Weight | 520.34 g/mol |
| Exact Mass | 519.08 |
| IUPAC Name | N'-[(E)-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]-N-(5-chloro-2-methoxyphenyl)oxamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)C(=O)N/N=C/c1ccc(OCc2c(F)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C24H20Cl2FN3O5/c1-33-20-9-7-15(25)11-19(20)29-23(31)24(32)30-28-12-14-6-8-21(22(10-14)34-2)35-13-16-17(26)4-3-5-18(16)27/h3-12H,13H2,1-2H3,(H,29,31)(H,30,32)/b28-12+ |
| InChIKey | SPNQFMMJRFKXNE-KVSWJAHQSA-N |
| XLogP | 4.82 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.34 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|