C24H17Cl3F3N3O3 — CID 5051458
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide (PubChem CID 5051458) has the molecular formula C24H17Cl3F3N3O3 and a molecular weight of 558.77 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 5051458 |
| Molecular Formula | C24H17Cl3F3N3O3 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 557.03 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-[1-[4-[(2,6-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide |
| SMILES | CC(=NNC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(OCc2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3F3N3O3/c1-13(14-5-8-16(9-6-14)36-12-17-18(25)3-2-4-19(17)26)32-33-23(35)22(34)31-21-11-15(24(28,29)30)7-10-20(21)27/h2-11H,12H2,1H3,(H,31,34)(H,33,35) |
| InChIKey | UTDTWPYPNJIHOO-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|