C22H21N3O2 — CID 19661535
N-(2-ethylphenyl)-N'-[(E)-1-naphthalen-1-ylethylideneamino]oxamide (PubChem CID 19661535) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-(2-ethylphenyl)-N'-[(E)-1-naphthalen-1-ylethylideneamino]oxamide.
| Compound Name | N-(2-ethylphenyl)-N'-[(E)-1-naphthalen-1-ylethylideneamino]oxamide |
|---|---|
| PubChem CID | 19661535 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(2-ethylphenyl)-N'-[(E)-1-naphthalen-1-ylethylideneamino]oxamide |
| SMILES | CCc1ccccc1NC(=O)C(=O)N/N=C(\C)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H21N3O2/c1-3-16-9-5-7-14-20(16)23-21(26)22(27)25-24-15(2)18-13-8-11-17-10-4-6-12-19(17)18/h4-14H,3H2,1-2H3,(H,23,26)(H,25,27)/b24-15+ |
| InChIKey | RJEQVMUQJJUAOM-BUVRLJJBSA-N |
| XLogP | 3.88 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|