C24H22BrN3O3 — CID 19660675
N-(4-bromophenyl)-N'-[(E)-1-[4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide (PubChem CID 19660675) has the molecular formula C24H22BrN3O3 and a molecular weight of 480.36 g/mol. Its IUPAC name is N-(4-bromophenyl)-N'-[(E)-1-[4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide.
| Compound Name | N-(4-bromophenyl)-N'-[(E)-1-[4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19660675 |
| Molecular Formula | C24H22BrN3O3 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | N-(4-bromophenyl)-N'-[(E)-1-[4-[(2-methylphenyl)methoxy]phenyl]ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccc(Br)cc1)c1ccc(OCc2ccccc2C)cc1 |
| InChI | InChI=1S/C24H22BrN3O3/c1-16-5-3-4-6-19(16)15-31-22-13-7-18(8-14-22)17(2)27-28-24(30)23(29)26-21-11-9-20(25)10-12-21/h3-14H,15H2,1-2H3,(H,26,29)(H,28,30)/b27-17+ |
| InChIKey | PQONNRBHZAKQJM-WPWMEQJKSA-N |
| XLogP | 4.82 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|