C24H20BrCl2N3O3 — CID 19658779
N-(4-bromo-2-methylphenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide (PubChem CID 19658779) has the molecular formula C24H20BrCl2N3O3 and a molecular weight of 549.25 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide |
|---|---|
| PubChem CID | 19658779 |
| Molecular Formula | C24H20BrCl2N3O3 |
| Molecular Weight | 549.25 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylideneamino]oxamide |
| SMILES | C/C(=N\NC(=O)C(=O)Nc1ccc(Br)cc1C)c1ccc(OCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H20BrCl2N3O3/c1-14-11-18(25)6-10-22(14)28-23(31)24(32)30-29-15(2)16-4-8-20(9-5-16)33-13-17-3-7-19(26)12-21(17)27/h3-12H,13H2,1-2H3,(H,28,31)(H,30,32)/b29-15+ |
| InChIKey | JLBHTEGIQRGBKN-WKULSOCRSA-N |
| XLogP | 6.12 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.25 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|