C23H19BrClN3O3 — CID 19660735
N-(4-bromo-2-methylphenyl)-N'-[(E)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 19660735) has the molecular formula C23H19BrClN3O3 and a molecular weight of 500.78 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-N'-[(E)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19660735 |
| Molecular Formula | C23H19BrClN3O3 |
| Molecular Weight | 500.78 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-N'-[(E)-[4-[(3-chlorophenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)C(=O)N/N=C/c1ccc(OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H19BrClN3O3/c1-15-11-18(24)7-10-21(15)27-22(29)23(30)28-26-13-16-5-8-20(9-6-16)31-14-17-3-2-4-19(25)12-17/h2-13H,14H2,1H3,(H,27,29)(H,28,30)/b26-13+ |
| InChIKey | RUKFKJKZLUBERH-LGJNPRDNSA-N |
| XLogP | 5.08 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.78 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|