C22H16BrF2N3O3 — CID 19658350
N-(4-bromo-2-fluorophenyl)-N'-[(E)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxamide (PubChem CID 19658350) has the molecular formula C22H16BrF2N3O3 and a molecular weight of 488.29 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-N'-[(E)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-N'-[(E)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxamide |
|---|---|
| PubChem CID | 19658350 |
| Molecular Formula | C22H16BrF2N3O3 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.03 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-N'-[(E)-[4-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]oxamide |
| SMILES | O=C(N/N=C/c1ccc(OCc2ccc(F)cc2)cc1)C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C22H16BrF2N3O3/c23-16-5-10-20(19(25)11-16)27-21(29)22(30)28-26-12-14-3-8-18(9-4-14)31-13-15-1-6-17(24)7-2-15/h1-12H,13H2,(H,27,29)(H,28,30)/b26-12+ |
| InChIKey | HNNGDBGPOOZRER-RPPGKUMJSA-N |
| XLogP | 4.40 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|