C28H27Cl2N3O5S — CID 5174383
ethyl 2-[[2-[2-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 5174383) has the molecular formula C28H27Cl2N3O5S and a molecular weight of 588.51 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 5174383 |
| Molecular Formula | C28H27Cl2N3O5S |
| Molecular Weight | 588.51 g/mol |
| Exact Mass | 587.10 |
| IUPAC Name | ethyl 2-[[2-[2-[1-[4-[(2,4-dichlorophenyl)methoxy]phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=C(C)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C28H27Cl2N3O5S/c1-3-37-28(36)24-21-6-4-5-7-23(21)39-27(24)31-25(34)26(35)33-32-16(2)17-9-12-20(13-10-17)38-15-18-8-11-19(29)14-22(18)30/h8-14H,3-7,15H2,1-2H3,(H,31,34)(H,33,35) |
| InChIKey | UGBQEKXUTRNRGH-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|