C23H26N4O6S — CID 19661269
ethyl 2-[[2-[(2E)-2-[1-[4-(2-amino-2-oxoethoxy)phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19661269) has the molecular formula C23H26N4O6S and a molecular weight of 486.55 g/mol. Its IUPAC name is ethyl 2-[[2-[(2E)-2-[1-[4-(2-amino-2-oxoethoxy)phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2E)-2-[1-[4-(2-amino-2-oxoethoxy)phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19661269 |
| Molecular Formula | C23H26N4O6S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | ethyl 2-[[2-[(2E)-2-[1-[4-(2-amino-2-oxoethoxy)phenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)N/N=C(\C)c2ccc(OCC(N)=O)cc2)sc2c1CCCC2 |
| InChI | InChI=1S/C23H26N4O6S/c1-3-32-23(31)19-16-6-4-5-7-17(16)34-22(19)25-20(29)21(30)27-26-13(2)14-8-10-15(11-9-14)33-12-18(24)28/h8-11H,3-7,12H2,1-2H3,(H2,24,28)(H,25,29)(H,27,30)/b26-13+ |
| InChIKey | ILKJFRJIKFEKDG-LGJNPRDNSA-N |
| XLogP | 2.15 |
| TPSA | 149.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|