C29H28ClN3O7S — CID 3680365
ethyl 2-[[2-[2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 3680365) has the molecular formula C29H28ClN3O7S and a molecular weight of 598.08 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 3680365 |
| Molecular Formula | C29H28ClN3O7S |
| Molecular Weight | 598.08 g/mol |
| Exact Mass | 597.13 |
| IUPAC Name | ethyl 2-[[2-[2-[1-[4-(3-chlorobenzoyl)oxy-3-methoxyphenyl]ethylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=C(C)c2ccc(OC(=O)c3cccc(Cl)c3)c(OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C29H28ClN3O7S/c1-4-39-29(37)24-20-10-5-6-11-23(20)41-27(24)31-25(34)26(35)33-32-16(2)17-12-13-21(22(15-17)38-3)40-28(36)18-8-7-9-19(30)14-18/h7-9,12-15H,4-6,10-11H2,1-3H3,(H,31,34)(H,33,35) |
| InChIKey | KAVOVQKKAQUSRC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|