C30H31N3O8S — CID 4083932
ethyl 2-[[2-[2-[[4-(4-ethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 4083932) has the molecular formula C30H31N3O8S and a molecular weight of 593.66 g/mol. Its IUPAC name is ethyl 2-[[2-[2-[[4-(4-ethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[2-[[4-(4-ethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 4083932 |
| Molecular Formula | C30H31N3O8S |
| Molecular Weight | 593.66 g/mol |
| Exact Mass | 593.18 |
| IUPAC Name | ethyl 2-[[2-[2-[[4-(4-ethoxybenzoyl)oxy-3-methoxyphenyl]methylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)NN=Cc2ccc(OC(=O)c3ccc(OCC)cc3)c(OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C30H31N3O8S/c1-4-39-20-13-11-19(12-14-20)29(36)41-22-15-10-18(16-23(22)38-3)17-31-33-27(35)26(34)32-28-25(30(37)40-5-2)21-8-6-7-9-24(21)42-28/h10-17H,4-9H2,1-3H3,(H,32,34)(H,33,35) |
| InChIKey | DNAIAAVRMBFSJA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 141.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.66 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|