C21H21N3O6S — CID 6050126
ethyl 2-[[2-[(2E)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 6050126) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is ethyl 2-[[2-[(2E)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[(2E)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6050126 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | ethyl 2-[[2-[(2E)-2-[(4-methoxycarbonylphenyl)methylidene]hydrazinyl]-2-oxoacetyl]amino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)N/N=C/c2ccc(C(=O)OC)cc2)sc2c1CCC2 |
| InChI | InChI=1S/C21H21N3O6S/c1-3-30-21(28)16-14-5-4-6-15(14)31-19(16)23-17(25)18(26)24-22-11-12-7-9-13(10-8-12)20(27)29-2/h7-11H,3-6H2,1-2H3,(H,23,25)(H,24,26)/b22-11+ |
| InChIKey | ZAEDHDVCEAUPMX-SSDVNMTOSA-N |
| XLogP | 2.29 |
| TPSA | 123.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|