C26H25N3O8S — CID 19661457
[4-[(E)-[[2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 19661457) has the molecular formula C26H25N3O8S and a molecular weight of 539.57 g/mol. Its IUPAC name is [4-[(E)-[[2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-[[2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19661457 |
| Molecular Formula | C26H25N3O8S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | [4-[(E)-[[2-[(3-ethoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C(=O)N/N=C/c2ccc(OC(=O)c3ccco3)c(OC)c2)sc2c1CCCC2 |
| InChI | InChI=1S/C26H25N3O8S/c1-3-35-26(33)21-16-7-4-5-9-20(16)38-24(21)28-22(30)23(31)29-27-14-15-10-11-17(19(13-15)34-2)37-25(32)18-8-6-12-36-18/h6,8,10-14H,3-5,7,9H2,1-2H3,(H,28,30)(H,29,31)/b27-14+ |
| InChIKey | FSRNBZBZHLZGKK-MZJWZYIUSA-N |
| XLogP | 3.71 |
| TPSA | 145.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|