C23H19N3O7S — CID 4671805
[2-[[[2-[(3-methoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate (PubChem CID 4671805) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is [2-[[[2-[(3-methoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-[[[2-[(3-methoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 4671805 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [2-[[[2-[(3-methoxycarbonyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)amino]-2-oxoacetyl]hydrazinylidene]methyl]phenyl] furan-2-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(=O)NN=Cc2ccccc2OC(=O)c2ccco2)sc2c1CCC2 |
| InChI | InChI=1S/C23H19N3O7S/c1-31-23(30)18-14-7-4-10-17(14)34-21(18)25-19(27)20(28)26-24-12-13-6-2-3-8-15(13)33-22(29)16-9-5-11-32-16/h2-3,5-6,8-9,11-12H,4,7,10H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | XKAQCVOWGHLESB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|